| Primary information |
|---|
| ID | 20394 |
| Pubchem ID | 515 |
| Name | 2-Hydroxyestradiol-3-methyl ether |
| Description | 2-Hydroxyestradiol-3-methylether is a methoxylated derivative of 2-hydroxyestradiol. 2-hydroxy estrogen metabolites can be converted to anticarcinogenic methoxylated metabolites (2-methoxyestrone and 2-methoxyestradiol; 2-hydroxyestrone and 2-hydroxyestradiol 3-methyl ether) by catechol O-methyltran |
| Synonym | 2-Hydroxy-1;2;3-butanetricarboxylic acid;2-Hydroxy-1;2;3-butanetricarboxylate;2-Methylcitrate;(2S;3S)-2-Methylcitrate;2-Hydroxybutane-1;2;3-tricarboxylate;2-Hydroxybutane-1;2;3-tricarboxylic acid;2-Me |
| Molecular Weight | 302.4079 |
| Formula | C19H26O3 |
| IUPAC | (1S;10R;11S;14S;15S)-5-methoxy-15-methyltetracyclo[8.7.0.0²;⁷.0¹¹;¹⁵]heptadeca-2(7);3;5-triene-4;14-diol |
| SMILE | [H][C@@]12CC[C@H](O)[C@@]1(C)CC[C@]1([H])C3=C(CC[C@@]21[H])C=C(OC)C(O)=C3 |
| PDB ID | NA |
| KEGG | NA |
| HMDB ID | HMDB0000380 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|