| Primary information |
|---|
| ID | 20392 |
| Pubchem ID | 53477688 |
| Name | 16-Oxoestrone |
| Description | Estrone (also oestrone) is an estrogenic hormone secreted by the ovary. Its molecular formula is C18H22O2. estrone has a melting point of 254.5 degrees Celsius. estrone is one of the three estrogens; which also include estriol and estradiol. |
| Synonym | 16-Ketoestrone;3-Hydroxy-1;3;5(10)-estratriene-16;17-dione;16-Ketoestrone;3-Hydroxy-1;3;5(10)-estratriene-16;17-dione;3-Hydroxy-1;3;5(10)-estratriene-16;17-dione |
| Molecular Weight | 284.3496 |
| Formula | C18H20O3 |
| IUPAC | (15S)-5-hydroxy-15-methyltetracyclo[8.7.0.0²;⁷.0¹¹;¹⁵]heptadeca-2(7);3;5-triene-13;14-dione |
| SMILE | C[C@]12CCC3C(CCC4=C3C=CC(O)=C4)C1CC(=O)C2=O |
| PDB ID | NA |
| KEGG | C14441 |
| HMDB ID | HMDB0000372 |
| Melting Point (Degree C) | 231 |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|