| Primary information |
|---|
| ID | 20388 |
| Pubchem ID | 68929 |
| Name | 16b-Hydroxyestradiol |
| Description | 16b-Hydroxyestradiol; which is better known as epiestriol (or 16beta-epiestriol or 16beta-hydroxy-17beta-estriol); belongs to the class of organic compounds known as estrogens and derivatives. These are steroids with a structure containing a 3-hydroxylated estrane. |
| Synonym | 16-Epiestriol;16beta;17beta-Estriol;Actriol;Epiestriol;Epiestriolum;Epioestriolum;Estra-1;3;5(10)-triene-3;16beta;17-triol;Estra-1;3;5(10)-triene-3;16beta;17beta-triol;16b;17b-Estriol;16Β;17β-estriol; |
| Molecular Weight | 288.3814 |
| Formula | C18H24O3 |
| IUPAC | (1S;10R;11S;13S;14R;15S)-15-methyltetracyclo[8.7.0.0^{2;7}.0^{11;15}]heptadeca-2(7);3;5-triene-5;13;14-triol |
| SMILE | [H][C@@]12C[C@H](O)[C@H](O)[C@@]1(C)CC[C@]1([H])C3=C(CC[C@@]21[H])C=C(O)C=C3 |
| PDB ID | NA |
| KEGG | NA |
| HMDB ID | HMDB0000347 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|