| Primary information |
|---|
| ID | 20387 |
| Pubchem ID | NA |
| Name | 2-Hydroxyestrone |
| Description | 2-Hydroxyestrone (2-OHE1); also known as estra-1;3;5(10)-trien-2;3-diol-17-one; is an endogenous; naturally occurring catechol estrogen and a major metabolite of estrone and estradiol. 2-Hydroxyestrone belongs to the class of organic compounds known as estrogens and derivatives. |
| Synonym | 2;3-Dihydroxyestra-1;3;5(10)-trien-17-one;2-OHE1;Catecholestrone;2-Hydroxyestrone; 4-(14)C-labeled;2;3-Dihydroxyestra-1;3;5(10)-trien-17-one;2-OHE1;Catecholestrone;2-Hydroxyestrone; 4-(14)C-labeled;2- |
| Molecular Weight | 286.3655 |
| Formula | C18H22O3 |
| IUPAC | (1S;10R;11S;15S)-4;5-dihydroxy-15-methyltetracyclo[8.7.0.0^{2;7}.0^{11;15}]heptadeca-2(7);3;5-trien-14-one |
| SMILE | [H][C@@]12CCC(=O)[C@@]1(C)CC[C@]1([H])C3=C(CC[C@@]21[H])C=C(O)C(O)=C3 |
| PDB ID | NA |
| KEGG | C05298 |
| HMDB ID | HMDB0000343 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|