| Primary information |
|---|
| ID | 20386 |
| Pubchem ID | 247304 |
| Name | 2-Hydroxyestradiol |
| Description | 2-Hydroxyestradiol (2-OHE2); also known as estra-1;3;5(10)-triene-2;3;17beta-triol; is an endogenous steroid; catechol estrogen. 2-Hydroxyestradiol belongs to the class of organic compounds known as estrogens and derivatives. |
| Synonym | (17beta)-Estra-1;3;5(10)-triene-2;3;17-triol;2-Hydroxyestradiol-17beta;2-OH-e2;2-OH-Estradiol;(17b)-Estra-1;3;5(10)-triene-2;3;17-triol;(17Β)-estra-1;3;5(10)-triene-2;3;17-triol;2-Hydroxyestradiol-17b |
| Molecular Weight | 288.3814 |
| Formula | C18H24O3 |
| IUPAC | (1S;10R;11S;14S;15S)-15-methyltetracyclo[8.7.0.0^{2;7}.0^{11;15}]heptadeca-2(7);3;5-triene-4;5;14-triol |
| SMILE | [H][C@@]12CC[C@H](O)[C@@]1(C)CC[C@]1([H])C3=C(CC[C@@]21[H])C=C(O)C(O)=C3 |
| PDB ID | NA |
| KEGG | C05301 |
| HMDB ID | HMDB0000338 |
| Melting Point (Degree C) | 190.5 |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|