| Primary information |
|---|
| ID | 20384 |
| Pubchem ID | 44263344 |
| Name | 18-Oxocortisol |
| Description | 18-Oxocortisol belongs to the class of organic compounds known as 21-hydroxysteroids. These are steroids carrying a hydroxyl group at the 21-position of the steroid backbone. Thus; 18-oxocortisol is considered to be a steroid. Based on a literature review a small amount of articles have been publish |
| Synonym | 11b;17;21-Trihydroxy-3;20-dioxo-pregn-4-en-18-al;11 beta;17 alpha;21-Trihydroxy-3;20-diketo-4-pregnene-18-al;11b;17;21-Trihydroxy-3;20-dioxo-pregn-4-en-18-al;11 beta;17 alpha;21-Trihydroxy-3;20-diketo |
| Molecular Weight | 376.4434 |
| Formula | C21H28O6 |
| IUPAC | (1S;2R;10S;11S;14S;15R;17S)-14;17-dihydroxy-14-(2-hydroxyacetyl)-2-methyl-5-oxotetracyclo[8.7.0.0²;⁷.0¹¹;¹⁵]heptadec-6-ene-15-carbaldehyde |
| SMILE | [H][C@@]12CC[C@@](O)(C(=O)CO)[C@]1(C[C@H](O)[C@@]1([H])[C@@]2([H])CCC2=CC(=O)CC[C@]12C)C=O |
| PDB ID | NA |
| KEGG | NA |
| HMDB ID | HMDB0000332 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|