Primary information |
---|
ID | 20381 |
Pubchem ID | 22833517 |
Name | 16b-Hydroxyestrone |
Description | 16b-Hydroxyestrone belongs to the class of organic compounds known as estrogens and derivatives. These are steroids with a structure containing a 3-hydroxylated estrane. Thus; 16b-hydroxyestrone is considered to be a steroid lipid molecule. 16b-Hydroxyestrone is a very hydrophobic molecule; practica |
Synonym | (16beta)-3;16-Dihydroxyestra-1;3;5(10)-trien-17-one;16-Hydroxyestrone;3;16-Dihydroxyestra-1;3;5(10)-trien-17-one;3;16beta-Dihydroxy-estra-1;3;5(10)-trien-17-one;(16b)-3;16-Dihydroxyestra-1;3;5(10)-tri |
Molecular Weight | 286.3655 |
Formula | C18H22O3 |
IUPAC | (1S;10R;11S;13S;15S)-5;13-dihydroxy-15-methyltetracyclo[8.7.0.0²;⁷.0¹¹;¹⁵]heptadeca-2(7);3;5-trien-14-one |
SMILE | [H][C@@]12C[C@H](O)C(=O)[C@@]1(C)CC[C@]1([H])C3=C(CC[C@@]21[H])C=C(O)C=C3 |
PDB ID | NA |
KEGG | C05300 |
HMDB ID | HMDB0000313 |
Melting Point (Degree C) | NA |
Water Solubility | NA |
Drugbank ID | NA |
Receptor | NA |
Reference | HMDB
|