| Primary information |
|---|
| ID | 20381 |
| Pubchem ID | 22833517 |
| Name | 16b-Hydroxyestrone |
| Description | 16b-Hydroxyestrone belongs to the class of organic compounds known as estrogens and derivatives. These are steroids with a structure containing a 3-hydroxylated estrane. Thus; 16b-hydroxyestrone is considered to be a steroid lipid molecule. 16b-Hydroxyestrone is a very hydrophobic molecule; practica |
| Synonym | (16beta)-3;16-Dihydroxyestra-1;3;5(10)-trien-17-one;16-Hydroxyestrone;3;16-Dihydroxyestra-1;3;5(10)-trien-17-one;3;16beta-Dihydroxy-estra-1;3;5(10)-trien-17-one;(16b)-3;16-Dihydroxyestra-1;3;5(10)-tri |
| Molecular Weight | 286.3655 |
| Formula | C18H22O3 |
| IUPAC | (1S;10R;11S;13S;15S)-5;13-dihydroxy-15-methyltetracyclo[8.7.0.0²;⁷.0¹¹;¹⁵]heptadeca-2(7);3;5-trien-14-one |
| SMILE | [H][C@@]12C[C@H](O)C(=O)[C@@]1(C)CC[C@]1([H])C3=C(CC[C@@]21[H])C=C(O)C=C3 |
| PDB ID | NA |
| KEGG | C05300 |
| HMDB ID | HMDB0000313 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|