Primary information |
---|
ID | 20375 |
Pubchem ID | 6057 |
Name | L-Tyrosine |
Description | Tyrosine (Tyr) or L-tyrosine is an alpha-amino acid. These are amino acids in which the amino group is attached to the carbon atom immediately adjacent to the carboxylate group (alpha carbon). |
Synonym | (-)-alpha-Amino-p-hydroxyhydrocinnamic acid;(2S)-2-Amino-3-(4-hydroxyphenyl)propanoic acid;(S)-(-)-Tyrosine;(S)-2-Amino-3-(p-hydroxyphenyl)propionic acid;(S)-3-(p-Hydroxyphenyl)alanine;(S)-alpha-Amino |
Molecular Weight | 181.1885 |
Formula | C9H11NO3 |
IUPAC | (2S)-2-amino-3-(4-hydroxyphenyl)propanoic acid |
SMILE | N[C@@H](CC1=CC=C(O)C=C1)C(O)=O |
PDB ID | NA |
KEGG | C00082 |
HMDB ID | HMDB0000158 |
Melting Point (Degree C) | 343 |
Water Solubility | 0.48 mg/mL |
Drugbank ID | NA |
Receptor | NA |
Reference | HMDB
|