| Primary information |
|---|
| ID | 20373 |
| Pubchem ID | 444791 |
| Name | D-Glucuronic acid |
| Description | Glucuronic acid (CAS: 6556-12-3) is a carboxylic acid that has the structure of a glucose molecule that has had its sixth carbon atom (of six total) oxidized. The salts of glucuronic acid are known as glucuronates. Glucuronic acid is highly soluble in water. |
| Synonym | GlcAa;GlcAalpha;D-Glucuronate;alpha-D-Glucopyranuronic acid;alpha-D-Glucuronic acid;D-(+)-Glucuronate;D-(+)-Glucuronic acid;GCU;Glucosiduronate;Glucosiduronic acid;Glucuronate;Glucuronic acid;D-Glucop |
| Molecular Weight | 194.1394 |
| Formula | C6H10O7 |
| IUPAC | (2S;3S;4S;5R;6S)-3;4;5;6-tetrahydroxyoxane-2-carboxylic acid |
| SMILE | O[C@H]1O[C@@H]([C@@H](O)[C@H](O)[C@H]1O)C(O)=O |
| PDB ID | NA |
| KEGG | C00191 |
| HMDB ID | HMDB0000127 |
| Melting Point (Degree C) | 143.5 |
| Water Solubility | 485 mg/mL |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|