Primary information |
---|
ID | 20371 |
Pubchem ID | 6076 |
Name | Cyclic AMP |
Description | Cyclic AMP (cAMP) or cyclic adenosine monophosphate is an adenine nucleotide containing one phosphate group which is esterified to both the 3'- and 5'-positions of the sugar moiety. cAMP is found in all organisms ranging from bacteria to plants to animals. |
Synonym | Adenosine 3';5'-cyclic monophosphate;Adenosine 3';5'-cyclic phosphate;Adenosine 3';5'-phosphate;ADENOSINE-3';5'-cyclic-monophosphATE;CAMP;Cyclic adenylic acid;Adenosine 3';5'-cyclic monophosphoric aci |
Molecular Weight | 329.2059 |
Formula | C10H12N5O6P |
IUPAC | (4aR;6R;7R;7aS)-6-(6-amino-9H-purin-9-yl)-2;7-dihydroxy-hexahydro-2lambda5-furo[3;2-d][1;3;2]dioxaphosphinin-2-one |
SMILE | [H][C@@]12COP(O)(=O)O[C@@]1([H])[C@@H](O)[C@@H](O2)N1C=NC2=C1N=CN=C2N |
PDB ID | NA |
KEGG | C00575 |
HMDB ID | HMDB0000058 |
Melting Point (Degree C) | 219.5 |
Water Solubility | 4 mg/mL |
Drugbank ID | NA |
Receptor | P34907; Q9TX43; P35352 |
Reference | HMDB
|