| Primary information |
|---|
| ID | 20370 |
| Pubchem ID | NA |
| Name | Ascorbic acid |
| Description | Ascorbic acid is found naturally in citrus fruits and many vegetables and is an essential nutrient in human diets. It is necessary to maintain connective tissue and bone. The biologically active form of ascorbic acid is vitamin C. |
| Synonym | Acide ascorbique;Acido ascorbico;Acidum ascorbicum;Acidum ascorbinicum;Ascoltin;Ascorbicap;Ascorbinsaeure;e 300;e-300;e300;L-(+)-Ascorbic acid;L-Ascorbate;Vitamin C;Monodehydroascorbate radical;Ascorb |
| Molecular Weight | 176.1241 |
| Formula | C6H8O6 |
| IUPAC | (5R)-5-[(1S)-1;2-dihydroxyethyl]-3;4-dihydroxy-2;5-dihydrofuran-2-one |
| SMILE | [H][C@@]1(OC(=O)C(O)=C1O)[C@@H](O)CO |
| PDB ID | NA |
| KEGG | C01041 |
| HMDB ID | HMDB0000044 |
| Melting Point (Degree C) | 191 |
| Water Solubility | 400 mg/mL at 40 °C |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|