| Primary information |
|---|
| ID | 20367 |
| Pubchem ID | 439744 |
| Name | Iodotyrosine |
| Description | Iodotyrosine is an iodated derivative of L-tyrosine. This is an early precursor to L-thyroxine; one of the primary thyroid hormones. In the thyroid gland; iodide is trapped; transported; and concentrated in the follicular lumen for thyroid hormone synthesis. |
| Synonym | (2S)-2-Amino-3-(4-hydroxy-3-iodophenyl)propanoic acid;3-IODO-tyrosine;MIT;(2S)-2-Amino-3-(4-hydroxy-3-iodophenyl)propanoate;3-Iodo-4-hydroxyphenylalanine;3-Iodo-L-tyrosine;3-Iodotyrosine;3-Monoiodo-L- |
| Molecular Weight | 307.0851 |
| Formula | C9H10INO3 |
| IUPAC | (2S)-2-amino-3-(4-hydroxy-3-iodophenyl)propanoic acid |
| SMILE | N[C@@H](CC1=CC=C(O)C(I)=C1)C(O)=O |
| PDB ID | NA |
| KEGG | C02515 |
| HMDB ID | HMDB0000021 |
| Melting Point (Degree C) | 205 |
| Water Solubility | 3 mg/mL |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|