| Primary information |
|---|
| ID | 20366 |
| Pubchem ID | 6166 |
| Name | Deoxycorticosterone |
| Description | 11-Deoxycorticosterone (also called desoxycortone; 21-hydroxyprogesterone; DOC; or simply deoxycorticosterone) is a steroid hormone produced by the adrenal gland that possesses mineralocorticoid activity and acts as a precursor to aldosterone. |
| Synonym | 21-Hydroxy-4-pregnene-3;20-dione;21-Hydroxyprogesterone;4-Pregnen-21-ol-3;20-dione;Cortexone;DESOXYCORTICOSTERONE;Desoxycortone;DOC;Kendall's desoxy compound b;Reichstein's substance Q;11-Dehydroxycor |
| Molecular Weight | 330.4611 |
| Formula | C21H30O3 |
| IUPAC | (1S;2R;10S;11S;14S;15S)-14-(2-hydroxyacetyl)-2;15-dimethyltetracyclo[8.7.0.0^{2;7}.0^{11;15}]heptadec-6-en-5-one |
| SMILE | [H][C@@]12CC[C@H](C(=O)CO)[C@@]1(C)CC[C@@]1([H])[C@@]2([H])CCC2=CC(=O)CC[C@]12C |
| PDB ID | NA |
| KEGG | C03205 |
| HMDB ID | HMDB0000016 |
| Melting Point (Degree C) | 141.5 |
| Water Solubility | 0.06 mg/mL at 37 °C |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|