| Primary information |
|---|
| ID | 20365 |
| Pubchem ID | 440707 |
| Name | Cortexolone |
| Description | Cortexolone; also known as cortodoxone or 11-deoxycortisol; belongs to the class of organic compounds known as 21-hydroxysteroids. These are steroids carrying a hydroxyl group at the 21-position of the steroid backbone. |
| Synonym | 11-Desoxy-17-hydroxycorticosterone;Cortodoxone;Reichstein substance S;Substance S; reichstein's;11 Deoxycortisol;11 Desoxycortisol;11 Desoxycortisone;S; Reichstein's substance;11-Desoxycortisol;11-Des |
| Molecular Weight | 346.4605 |
| Formula | C21H30O4 |
| IUPAC | (1S;2R;10R;11S;14R;15S)-14-hydroxy-14-(2-hydroxyacetyl)-2;15-dimethyltetracyclo[8.7.0.0^{2;7}.0^{11;15}]heptadec-6-en-5-one |
| SMILE | [H][C@@]12CC[C@](O)(C(=O)CO)[C@@]1(C)CC[C@@]1([H])[C@@]2([H])CCC2=CC(=O)CC[C@]12C |
| PDB ID | NA |
| KEGG | C05488 |
| HMDB ID | HMDB0000015 |
| Melting Point (Degree C) | 215 |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|