Primary information |
---|
ID | 20364 |
Pubchem ID | 440624 |
Name | 2-Methoxyestrone |
Description | 2-Methoxyestrone (or 2-ME1) belongs to the class of organic compounds known as estrogens and derivatives. These are steroids with a structure containing a 3-hydroxylated estrane. Thus; 2-methoxyestrone is considered to be a steroid or steroid derivative. |
Synonym | 2-(8S;9S;13S;14S)-3-Hydroxy-2-methoxy-13-methyl-7;8;9;11;12;14;15;16-octahydro-6H-cyclopenta[a]phenanthren-17-one;2-Hydroxyestrone 2-methyl ether;2-Methoxy-17-oxoestra-1;3;5(10)-trien-3-ol;2-Methoxy-3 |
Molecular Weight | 300.3921 |
Formula | C19H24O3 |
IUPAC | (1S;10R;11S;15S)-5-hydroxy-4-methoxy-15-methyltetracyclo[8.7.0.0^{2;7}.0^{11;15}]heptadeca-2(7);3;5-trien-14-one |
SMILE | [H][C@@]12CCC(=O)[C@@]1(C)CC[C@]1([H])C3=C(CC[C@@]21[H])C=C(O)C(OC)=C3 |
PDB ID | NA |
KEGG | C05299 |
HMDB ID | HMDB0000010 |
Melting Point (Degree C) | 188 |
Water Solubility | NA |
Drugbank ID | NA |
Receptor | NA |
Reference | HMDB
|