| Primary information |
|---|
| ID | 20362 |
| Pubchem ID | 5997 |
| Name | Cholesterol |
| Description | The principal sterol of all higher animals; distributed in body tissues; especially the brain and spinal cord; and in animal fats and oils. |
| Synonym | cholesterol Cholesterin Cordulan Dusoline Dusoran Cholesterine Hydrocerin Provitamin D |
| Molecular Weight | 386.65 |
| Formula | C27H46O |
| IUPAC | (3S;8S;9S;10R;13R;14S;17R)-10;13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2;3;4;7;8;9;11;12;14;15;16;17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILE | CC(C)CCCC(C)C1CCC2C1(CCC3C2CC=C4C3(CCC(C4)O)C)C |
| PDB ID | 1LRI;1N83;1ZHY;2RH1;3D4S |
| KEGG | C00187 |
| HMDB ID | HMDB0000067 |
| Melting Point (Degree C) | 148.5 |
| Water Solubility | 0.095mg/ml |
| Drugbank ID | DB04540 |
| Receptor | P35398; P51448 |
| Reference | HMDB
|