| Primary information |
|---|
| ID | 20361 |
| Pubchem ID | 5280497 |
| Name | Thromboxane A2 |
| Description | An unstable intermediate between the prostaglandin endoperoxides and thromboxane B2. The compound has a bicyclic oxaneoxetane structure. It is a potent inducer of platelet aggregation and causes vasoconstriction. It is the principal component of rabbit aorta contracting substance (RCS). |
| Synonym | Thromboxane A2 TXA2 TXA-2 9S;11S-epoxy;15S-hydroxy-thromboxa-5Z;13E-dien-1-oic acid |
| Molecular Weight | 352.47 |
| Formula | C20H32O5 |
| IUPAC | (Z)-7-[(1S;2S;3R;5S)-3-[(E;3S)-3-hydroxyoct-1-enyl]-4;7-dioxabicyclo[3.1.1]heptan-2-yl]hept-5-enoic acid |
| SMILE | CCCCCC(C=CC1C(C2CC(O2)O1)CC=CCCCC(=O)O)O |
| PDB ID | NA |
| KEGG | C02198 |
| HMDB ID | HMDB0001452 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | P21731 |
| Reference | HMDB
|