| Primary information |
|---|
| ID | 20360 |
| Pubchem ID | 5280363 |
| Name | prostaglandin F2alpha |
| Description | A naturally occurring prostaglandin that has oxytocic; luteolytic; and abortifacient activities. Due to its vasocontractile properties; the compound has a variety of other biological actions. |
| Synonym | Dinoprost amoglandin cyclosin panacelan Protamodin Enzaprost Enzaprost F Cerviprost PGF2alpha prostaglandin F2alpha |
| Molecular Weight | 354.48 |
| Formula | C20H34O5 |
| IUPAC | (Z)-7-[(1R;2R;3R;5S)-3;5-dihydroxy-2-[(E;3S)-3-hydroxyoct-1-enyl]cyclopentyl]hept-5-enoic acid |
| SMILE | CCCCCC(C=CC1C(CC(C1CC=CCCCC(=O)O)O)O)O |
| PDB ID | NA |
| KEGG | C00639; D00081 |
| HMDB ID | HMDB0001139 |
| Melting Point (Degree C) | 30 |
| Water Solubility | 2.58mg/ml |
| Drugbank ID | NA |
| Receptor | P43088; Q62786; Q9P2B2; Q9WV91; P37289 |
| Reference | HMDB
|