| Primary information |
|---|
| ID | 20359 |
| Pubchem ID | 5280360 |
| Name | Prostaglandin E2 |
| Description | The most common and most biologically active of the mammalian prostaglandins. It exhibits most biological activities characteristic of prostaglandins and has been used extensively as an oxytocic agent. The compound also displays a protective effect on the intestinal mucosa. |
| Synonym | Dinoprostone Dinoprostone Prostaglandin E2 Dinoprostone Dinoproston Prepidil Prostin PGE2 Dinoprostone Prostin E2 Cervidil Glandin l-Prostaglandin E2 |
| Molecular Weight | 352.47 |
| Formula | C20H32O5 |
| IUPAC | (Z)-7-[(1R;2R;3R)-3-hydroxy-2-[(E;3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]hept-5-enoic acid |
| SMILE | CCCCCC(C=CC1C(CC(=O)C1CC=CCCCC(=O)O)O)O |
| PDB ID | NA |
| KEGG | C00584; D00079 |
| HMDB ID | HMDB0001220 |
| Melting Point (Degree C) | 67 |
| Water Solubility | 58.1mg/ml |
| Drugbank ID | DB00917 |
| Receptor | P34995; P43116; P43115; P35408; Q9Z2J6; P35375; P70597; Q9BGL8; P43116; Q62053; Q62928 |
| Reference | HMDB
|