| Primary information |
|---|
| ID | 20357 |
| Pubchem ID | 448457 |
| Name | Prostaglandin D2 |
| Description | The principal cyclooxygenase metabolite of arachidonic acid. It is released upon activation of mast cells and is also synthesized by alveolar macrophages. Among its many biological actions; the most important are its bronchoconstrictor; platelet-activating-factor-inhibitory; and cytotoxic effect |
| Synonym | prostaglandin D2 Prostaglandin D2 PGD2 Prostaglandin D2 11-Dehydroprostaglandin F2-alpha |
| Molecular Weight | 352.47 |
| Formula | C20H32O5 |
| IUPAC | (Z)-7-[(1R;2R;5S)-5-hydroxy-2-[(E;3S)-3-hydroxyoct-1-enyl]-3-oxocyclopentyl]hept-5-enoic acid |
| SMILE | CCCCCC(C=CC1C(C(CC1=O)O)CC=CCCCC(=O)O)O |
| PDB ID | 1RY0 |
| KEGG | C00696 |
| HMDB ID | HMDB0001403 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | DB02056 |
| Receptor | Q13258; Q13258, Q9Y5Y4; P70263; Q9R261; Q9Z2J6 |
| Reference | HMDB
|