| Primary information |
|---|
| ID | 20355 |
| Pubchem ID | 5282411 |
| Name | Prostacyclin |
| Description | A prostaglandin that is a powerful vasodilator and inhibits platelet aggregation. It is biosynthesized enzymatically from PROSTAGLANDIN ENDOPEROXIDES in human vascular tissue. The sodium salt has been also used to treat primary pulmonary hypertension (HYPERTENSION; PULMONARY). |
| Synonym | epoprostenol prostacyclin Vasocyclin Flolan Prostaglandin X Prostacyclin I2 prostaglandin I2 PGI2 |
| Molecular Weight | 352.47 |
| Formula | C20H32O5 |
| IUPAC | (5Z)-5-[(3aR;4R;5R;6aS)-5-hydroxy-4-[(E;3S)-3-hydroxyoct-1-enyl]-3;3a;4;5;6;6a-hexahydrocyclopenta[d]furan-2-ylidene]pentanoic acid |
| SMILE | CCCCCC(C=CC1C(CC2C1CC(=CCCCC(=O)O)O2)O)O |
| PDB ID | NA |
| KEGG | C01312; D00106 |
| HMDB ID | HMDB0001335 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | DB01240 |
| Receptor | P43119 |
| Reference | HMDB
|