| Primary information |
|---|
| ID | 20351 |
| Pubchem ID | 5280879 |
| Name | Leukotriene E4 |
| Description | A biologically active principle of SRS-A that is formed from LEUKOTRIENE D4 via a peptidase reaction that removes the glycine residue. The biological actions of LTE4 are similar to LTC4 and LTD4. (From Dictionary of Prostaglandins and Related Compounds; 1990) |
| Synonym | leukotriene E4 Leukotriene E4 LTE4 5S-hydroxy;6R-(S-cysteinyl);7E;9E;11Z;14Z-eicosatetraenoic acid (7E;9E;11Z;14Z)-(5S;6R)-6-(Cystein-S-yl)-5-hydroxyeicosa-7;9;11;1 4-tetraenoate |
| Molecular Weight | 439.61 |
| Formula | C23H37NO5S |
| IUPAC | (5S;6R;7E;9E;11Z;14Z)-6-[(2R)-2-amino-3-hydroxy-3-oxopropyl]sulfanyl-5-hydroxyicosa-7;9;11;14-tetraenoic acid |
| SMILE | CCCCCC=CCC=CC=CC=CC(C(CCCC(=O)O)O)SCC(C(=O)O)N |
| PDB ID | NA |
| KEGG | C05952 |
| HMDB ID | NA |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | Q9NS75; Q9Y271 |
| Reference | HMDB
|