| Primary information |
|---|
| ID | 20350 |
| Pubchem ID | 5280878 |
| Name | Leukotriene D4 |
| Description | One of the biologically active principles of SRS-A. It is generated from LEUKOTRIENE C4 after partial hydrolysis of the peptide chain; i.e.; cleavage of the gamma-glutamyl portion. Its biological actions include stimulation of vascular and nonvascular smooth muscle; and increases in vascular per |
| Synonym | leukotriene D4 Leukotriene D4 LTD4 5S-hydroxy-6R-(S-cysteinylglycinyl)-7E;9E;11E;14Z-eicosatetraenoi (R-(R*;S*-(E;E;Z;Z)))-N-(S-(1-(4-Carboxy-1-hydroxybutyl)-2;4;6;9- pentadecatetraenyl)-L-cysteiny |
| Molecular Weight | 496.66 |
| Formula | C25H40N2O6S |
| IUPAC | (5S;6R;7E;9E;11Z;14Z)-6-[(2R)-2-amino-3-(carboxymethylamino)-3-oxopropyl]sulfanyl-5-hydroxyicosa-7;9;11;14-tetraenoicacid |
| SMILE | CCCCCC=CCC=CC=CC=CC(C(CCCC(=O)O)O)SCC(C(=O)NCC(=O)O)N |
| PDB ID | NA |
| KEGG | C05951 |
| HMDB ID | NA |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | Q9NS75; Q9Y271 |
| Reference | HMDB
|