| Primary information |
|---|
| ID | 20349 |
| Pubchem ID | 5280493 |
| Name | Leukotriene C4 |
| Description | The conjugation product of LEUKOTRIENE A4 and glutathione. It is the major arachidonic acid metabolite in macrophages and human mast cells as well as in antigen-sensitized lung tissue. |
| Synonym | leukotriene C4 Leukotriene C4 LTC4 LTC (sub 4) 5S;6R-Ltc(sub 4) |
| Molecular Weight | 625.77 |
| Formula | C30H47N3O9S |
| IUPAC | (5S;6R;7E;9E;11Z;14Z)-6-[(2R)-2-[[(4S)-4-amino-5-hydroxy-5-oxopentanoyl]amino]-3-(carboxymethylamino)-3-oxopropyl]sulfanyl-5-hydroxyicosa-7;9;11;14-tetraenoic acid |
| SMILE | CCCCCC=CCC=CC=CC=CC(C(CCCC(=O)O)O)SCC(C(=O)NCC(=O)O)NC(=O)CCC(C(=O)O)N |
| PDB ID | NA |
| KEGG | C02166 |
| HMDB ID | HMDB0001198 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | Q9NS75; Q9Y271 |
| Reference | HMDB
|