| Primary information |
|---|
| ID | 20344 |
| Pubchem ID | 5280492 |
| Name | Leukotriene B4 |
| Description | The major metabolite in neutrophil polymorphonuclear leukocytes. It stimulates polymorphonuclear cell function (degranulation; formation of oxygen-centered free radicals; arachidonic acid release; and metabolism). (From Dictionary of Prostaglandins and Related Compounds; 1990) |
| Synonym | LEUKOTRIENE B4 LTB4 Leukotriene- B4 5;12-Dihete 5;12-Hete |
| Molecular Weight | 336.47 |
| Formula | C20H32O4 |
| IUPAC | (5S;6Z;8E;10E;12R;14Z)-5;12-dihydroxyicosa-6;8;10;14-tetraenoic acid |
| SMILE | CCCCCC=CCC(C=CC=CC=CC(CCCC(=O)O)O)O |
| PDB ID | NA |
| KEGG | C02165 |
| HMDB ID | HMDB0001085 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | Q15722; Q9Y271; Q9NPC1; Q9NPC1; Q15722; Q9JJL9; O88855; Q9R0Q2; Q3T181; Q924U0 |
| Reference | HMDB
|