| Primary information |
|---|
| ID | 20322 |
| Pubchem ID | 14985 |
| Name | Alpha-Tocopherol |
| Description | A generic descriptor for all TOCOPHEROLS and TOCOTRIENOLS that exhibit ALPHA-TOCOPHEROL activity. By virtue of the phenolic hydrogen on the 2H-1-benzopyran-6-ol nucleus; these compounds exhibit varying degree of antioxidant activity; depending on the site and number of methyl groups and the type |
| Synonym | alpha-Tocopherol Vitamin E Ephanyl Phytogermine Waynecomycin Viteolin Eprolin Vitaped Esorb Aquasol E |
| Molecular Weight | 430.71 |
| Formula | C29H50O2 |
| IUPAC | (2R)-2;5;7;8-tetramethyl-2-[(4R;8R)-4;8;12-trimethyltridecyl]chroman-6-ol |
| SMILE | CC1=C(C(=C2CCC(OC2=C1C)(C)CCCC(C)CCCC(C)CCCC(C)C)C)O |
| PDB ID | 1R5L;1OIP |
| KEGG | C02477 |
| HMDB ID | HMDB0001893 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|