| Primary information |
|---|
| ID | 20315 |
| Pubchem ID | 30322 |
| Name | Digoxin |
| Description | A cardiotonic glycoside obtained mainly from Digitalis lanata; it consists of three sugars and the aglycone DIGOXIGENIN. Digoxin has positive inotropic and negative chronotropic activity. |
| Synonym | Digoxin Cardiogoxin Coragoxine Lanacordin Lanoxicaps Lenoxicaps Neodioxanin Acygoxin Cardigox Cardioxin |
| Molecular Weight | 780.94 |
| Formula | C41H64O14 |
| IUPAC | 4-[(3S;5R;8R;9S;10S;12R;13S;14S)-3-[(2R;4S;5S;6R)-5-[(2S;4S;5S;6R)-5-[(2S;4S;5S;6R)-4;5-dihydroxy-6-methyloxan-2-yl]oxy-4-hydroxy-6-methyloxan-2-yl]oxy-4-hydroxy-6-methyloxan-2-yl]oxy-12;14-dihydroxy-10;13-dimethyl-1;2;3;4;5;6;7;8;9;11;12;15;16;17-tetradecahydrocyclopenta[a]phenanthren-17-yl]-5H-furan-2-one |
| SMILE | CC1C(C(CC(O1)OC2C(OC(CC2O)OC3C(OC(CC3O)OC4CCC5(C(C4)CCC6C5CC(C7(C6(CCC7C8=CC(=O)OC8)O)C)O)C)C)C)O)O |
| PDB ID | NA |
| KEGG | C06956 |
| HMDB ID | HMDB0001917 |
| Melting Point (Degree C) | 1.26 |
| Water Solubility | NA |
| Drugbank ID | DB00390 |
| Receptor | NA |
| Reference | HMDB
|