| Primary information |
|---|
| ID | 20312 |
| Pubchem ID | 150890 |
| Name | 16-Oxoandrostenediol |
| Description | synthesized by hepatic microsomes from previable and anencephalic human fetuses; abundant steroid of umbilical cord blood and the physiologic precursor for 16-ketoestradiol-17 beta; major urinary estrogen of human pregnancy; structure |
| Synonym | 16-Oxoandrostenediol 3 beta;17 beta-dihydroxyandrost-5-en-16-one 16-Ketoandrostenediol Androst-5-en-16-one; 3;17-dihydroxy-; (3.beta.;17.beta.)- Androst-5-en-16-one; 3;17-dihydroxy-; (3beta;17beta) |
| Molecular Weight | 304.42 |
| Formula | C19H28O3 |
| IUPAC | (3S;8R;9S;10R;13S;14S;17R)-3;17-dihydroxy-10;13-dimethyl-1;2;3;4;7;8;9;11;12;14;15;17-dodecahydrocyclopenta[a]phenanthren-16-one |
| SMILE | CC12CCC(CC1=CCC3C2CCC4(C3CC(=O)C4O)C)O |
| PDB ID | NA |
| KEGG | NA |
| HMDB ID | HMDB0000322 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|