| Primary information |
|---|
| ID | 20295 |
| Pubchem ID | 440567 |
| Name | Taurocholic Acid |
| Description | The product of conjugation of cholic acid with taurine. Its sodium salt is the chief ingredient of the bile of carnivorous animals. It acts as a detergent to solubilize fats for absorption and is itself absorbed. It is used as a cholagogue and cholerectic. |
| Synonym | Cholyltaurine Taurocholic Acid Taurocholate |
| Molecular Weight | 515.7 |
| Formula | C26H45NO7S |
| IUPAC | 2-[4-[(3R;5S;7R;12S)-3;7;12-trihydroxy-10;13-dimethyl-2;3;4;5;6;7;8;9;11;12;14;15;16;17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoylamino]ethanesulfonic acid |
| SMILE | CC(CCC(=O)NCCS(=O)(=O)O)C1CCC2C1(C(CC3C2C(CC4C3(CCC(C4)O)C)O)O)C |
| PDB ID | NA |
| KEGG | C05122 |
| HMDB ID | HMDB0000036 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | Q3SZL0; Q96RI1; Q60641; Q62735; Q811W9; Q811X0; Q811X1; Q811X2; Q8JHU2 |
| Reference | HMDB
|