| Primary information |
|---|
| ID | 20278 |
| Pubchem ID | 6434253 |
| Name | 24;25-Dihydroxyvitamin D3 |
| Description | A physiologically active metabolite of VITAMIN D. The compound is involved in the regulation of calcium metabolism; alkaline phosphatase activity; and enhances the calcemic effect of CALCITRIOL. |
| Synonym | 24;25-Dihydroxyvitamin D 24;25-dihydroxyvitamin D3 24;25-Dihydroxycholecalciferol (3beta;5Z;7E)-9;10-Secocholesta-5;7;10(19)-triene-3;24;25-triol |
| Molecular Weight | 416.64 |
| Formula | C27H44O3 |
| IUPAC | (6R)-6-[(1R;3aS;4E;7aR)-4-[(2Z)-2-[(5S)-5-hydroxy-2-methylidenecyclohexylidene]ethylidene]-7a-methyl-2;3;3a;5;6;7-hexahydro-1H-inden-1-yl]-2-methylheptane-2;3-diol |
| SMILE | CC(CCC(C(C)(C)O)O)C1CCC2C1(CCCC2=CC=C3CC(CCC3=C)O)C |
| PDB ID | NA |
| KEGG | NA |
| HMDB ID | HMDB0000430 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|