| Primary information |
|---|
| ID | 20276 |
| Pubchem ID | NA |
| Name | 3a;16a-Dihydroxyandrostenone |
| Description | 3a;16a-Dihydroxyandrostenone is the most abundant single urinary metabolite of 16a-hydroxydehydroisoandrosterone (PMID 6049445); present in normal; non-pregnant human. It was found in the urine sample from a patient who had an inoperable asymptomatic adrenal carcinoma and who excreted about 5 mg/day |
| Synonym | 3a;16a-Dihydroxyandrost-5-en-17-one#3a;16a-Dihydroxyandrostenone |
| Molecular Weight | 304.42 |
| Formula | C19H28O3 |
| IUPAC | (3a;16a)-3;16-dihydroxy-Androst-5-en-17-one |
| SMILE | CC12CC(O)CC1C3CCC4CC(O)=CC(=O)C4(C)C3CC2 |
| PDB ID | NA |
| KEGG | NA |
| HMDB ID | HMDB0000324 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|