| Primary information |
|---|
| ID | 20275 |
| Pubchem ID | 439423 |
| Name | 7-dehydrocholesterol |
| Description | RN given refers to (3beta)-isomer; structure; main provitamin in skin that is converted by sunlight to cholecalciferol (vitamin D3) |
| Synonym | 7-Dehydrocholesterol Provitamin D3 Dehydrocholesterol Cholesta-5;7-dien-3beta-ol 5;7-Cholestadien-3-beta-ol 3beta-Hydroxy-5;7-cholestadiene |
| Molecular Weight | 384.64 |
| Formula | C27H44O |
| IUPAC | (3S;9S;10R;13R;14R;17R)-10;13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2;3;4;9;11;12;14;15;16;17-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILE | CC(C)CCCC(C)C1CCC2C1(CCC3C2=CC=C4C3(CCC(C4)O)C)C |
| PDB ID | NA |
| KEGG | C01164 |
| HMDB ID | HMDB0000032 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|