| Primary information |
|---|
| ID | 20272 |
| Pubchem ID | NA |
| Name | 25-Hydroxytachysterol3 |
| Description | 25-Hydroxytachysterol3 is a hydroxylated derivative of tachysterol3. 25-hydroxytachysterol is converted to 25-hydroxyprevitamin D3; which is then converted to the hydroxyvitamin D3 through a thermally induced rearrangement. It is now established that; during exposure to sunlight; the cutaneous reser |
| Synonym | 9;10-Secocholesta-5(10);6;8-triene-3;25-diol#25-Hydroxytachysterol3#25-Hydroxytachysterol |
| Molecular Weight | 400.64 |
| Formula | C27H44O2 |
| IUPAC | NA |
| SMILE | CC(CCCC(C)(C)O)C1CCC2C(=CCCC12C)C=CC1=C(C)CCCC1O |
| PDB ID | NA |
| KEGG | NA |
| HMDB ID | HMDB0006722 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|