| Primary information |
|---|
| ID | 20267 |
| Pubchem ID | NA |
| Name | 7-a;25-Dihydroxycholesterol |
| Description | 7 alpha-hydroxylation is not directly involved; positively or negatively; in the action of 25- or 27-hydroxycholesterol as suppressors of HMG-CoA reductase activity. Human diploid fibroblasts (HDF) and the human melanoma cell line SK-MEL-2 converted 25-hydroxycholesterol into 7 alpha;25-dihydroxycho |
| Synonym | 7alpha;25-Dihydroxycholesterol#Cholest-5-ene-3beta;7alpha;25-triol#7-alpha;25-Dihydroxycholesterol#Cholest-5-ene-3-beta;7-alpha;25-triol#Cholest-5-ene-3-b;7-a;25-triol#Cholest-5-ene-3b;7a;25-triol#7-a |
| Molecular Weight | 418.65 |
| Formula | C27H46O3 |
| IUPAC | cholest-5-ene-3beta;7alpha;25-triol |
| SMILE | CC(CCCC(C)(C)O)C1CCC2C3C(O)C=C4CC(O)CCC4(C)C3CCC12C |
| PDB ID | NA |
| KEGG | C15520 |
| HMDB ID | HMDB0006280 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|