| Primary information |
|---|
| ID | 20249 |
| Pubchem ID | 440558 |
| Name | Cholesta-5;7;24-trien-3 beta-ol |
| Description | major metabolite of incubation in vitro of mevalonic acid with yeast; structure |
| Synonym | 7-Dehydrodesmosterol cholesta-5;7;24-trien-3 beta-ol 24-Dehydroprovitamin D3 cholesta-5;7;24-trien-3 beta-ol cholest-5Z;7Z;24-trien-3beta-ol (3beta)-cholesta-5;7;24-trien-3-ol Cholesta-5;7;24-trie |
| Molecular Weight | 382.62 |
| Formula | C27H42O |
| IUPAC | (3S;9S;10R;13R;14R;17R)-10;13-dimethyl-17-[(2R)-6-methylhept-5-en-2-yl]-2;3;4;9;11;12;14;15;16;17-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILE | CC(CCC=C(C)C)C1CCC2C1(CCC3C2=CC=C4C3(CCC(C4)O)C)C |
| PDB ID | NA |
| KEGG | C05107 |
| HMDB ID | HMDB0003896 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|