| Primary information |
|---|
| ID | 20244 |
| Pubchem ID | NA |
| Name | (3a;5b)-24-oxo-24-[(2-sulfoethyl)amino]cholan-3-yl-b-D-Glucopyranosiduronic acid |
| Description | (3a;5b)-24-oxo-24-[(2-sulfoethyl)amino]cholan-3-yl-b-D-Glucopyranosiduronic acid is a natural human metabolite of Taurolithocholic acid generated in the liver by UDP glucuonyltransferase.Glucuronidation is used to assist in the excretion of toxic substances; drugs or other substances that cannot be |
| Synonym | (3a;5b)-24-oxo-24-[(2-sulfoethyl)amino]cholan-3-yl-b-D-Glucopyranosiduronate#Taurolithocholic acid 3-glucuronide#(3a;5b)-24-oxo-24-[(2-sulfoethyl)amino]cholan-3-yl-beta-delta-Glucopyranosiduronate |
| Molecular Weight | 659.83 |
| Formula | C32H53NO11S |
| IUPAC | (3a;5b)-24-oxo-24-[(2-sulfoethyl)amino]cholan-3-yl b-D-glucopyranosiduronic acid |
| SMILE | CC(CCC(=O)NCCS(O)(=O)=O)C1CCC2C3CCC4CC(CCC4(C)C3CCC12C)OC1OC(C(O)C(O)C1O)C(O)=O |
| PDB ID | NA |
| KEGG | NA |
| HMDB ID | HMDB0002429 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|