| Primary information |
|---|
| ID | 20237 |
| Pubchem ID | 160520 |
| Name | 3;7;12-trihydroxycoprostane |
| Description | intermediate in bile acid synthesis in liver; enhances rate of porphyrin synthesis in cultured liver cells by induction of delta-aminolevulinic acid synthetase; RN given refers to (3alpha;5beta;7alpha;12alpha)-isomer; structure |
| Synonym | Trihydroxycoprostane 3;7;12-Trihydroxycoprostane 5beta-Cholestane-3alpha;7alpha;12alpha-triol 3alpha;7alpha;12alpha-Trihydroxycoprostane 3alpha;7alpha;12alpha-Trihydroxy-5beta-cholestane |
| Molecular Weight | 420.67 |
| Formula | C27H48O3 |
| IUPAC | (3R;5S;7R;8R;9S;10S;12S;13R;14S;17R)-10;13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2;3;4;5;6;7;8;9;11;12;14;15;16;17-tetradecahydro-1H-cyclopenta[a]phenanthrene-3;7;12-triol |
| SMILE | CC(C)CCCC(C)C1CCC2C1(C(CC3C2C(CC4C3(CCC(C4)O)C)O)O)C |
| PDB ID | NA |
| KEGG | C05454 |
| HMDB ID | HMDB0001457 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|