| Primary information |
|---|
| ID | 20230 |
| Pubchem ID | 444679 |
| Name | Ergosterol |
| Description | A steroid of interest both because its biosynthesis in FUNGI is a target of ANTIFUNGAL AGENTS; notably AZOLES; and because when it is present in SKIN of animals; ULTRAVIOLET RAYS break a bond to result in ERGOCALCIFEROL. |
| Synonym | Ergosterol Provitamin D2 Ergosterin 5;7;22-Ergostatrien-3beta-ol |
| Molecular Weight | 396.65 |
| Formula | C28H44O |
| IUPAC | (3S;9S;10R;13R;14R;17R)-17-[(E;2R;5R)-5;6-dimethylhept-3-en-2-yl]-10;13-dimethyl-2;3;4;9;11;12;14;15;16;17-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILE | CC(C)C(C)C=CC(C)C1CCC2C1(CCC3C2=CC=C4C3(CCC(C4)O)C)C |
| PDB ID | 1BXM |
| KEGG | C01694 |
| HMDB ID | HMDB0000878 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|