| Primary information |
|---|
| ID | 20226 |
| Pubchem ID | 5202 |
| Name | Serotonin |
| Description | A biochemical messenger and regulator; synthesized from the essential amino acid L-TRYPTOPHAN. In humans it is found primarily in the central nervous system; gastrointestinal tract; and blood platelets. Serotonin mediates several important physiological functions including neurotransmission; gas |
| Synonym | Serotonin Enteramine Serotonine Thrombocytin Thrombotonin Antemoqua Antemovis Hippophain |
| Molecular Weight | 176.22 |
| Formula | C10H12N2O |
| IUPAC | 3-(2-aminoethyl)-1H-indol-5-ol |
| SMILE | C1=CC2=C(C=C1O)C(=CN2)CCN |
| PDB ID | 2QEH;3BRN |
| KEGG | C00780 |
| HMDB ID | HMDB0000259 |
| Melting Point (Degree C) | 167.5 |
| Water Solubility | 2.00E+04mg/ml |
| Drugbank ID | NA |
| Receptor | P47898; Q13639; P28335; P28223; P46098; P18089; P08913 |
| Reference | Endonet
|