| Primary information |
|---|
| ID | 20225 |
| Pubchem ID | 6743 |
| Name | Stigmastanol |
| Description | saturated analog of beta-sitosterol; RN given refers to (3beta;5alpha)-isomer |
| Synonym | Fucostanol Spinastanol Dihydrositosterin sitostanol stigmastanol STIGMASTANOL stigmastanol beta-Sitostanol Dihydrositosterol 24alpha-Ethylcholestanol Stigmastane-3-beta-ol beta-Sitosterol; dihy |
| Molecular Weight | 416.72 |
| Formula | C29H52O |
| IUPAC | 17-(5-ethyl-6-methylheptan-2-yl)-10;13-dimethyl-2;3;4;5;6;7;8;9;11;12;14;15;16;17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILE | CCC(CCC(C)C1CCC2C1(CCC3C2CCC4C3(CCC(C4)O)C)C)C(C)C |
| PDB ID | NA |
| KEGG | C00001 |
| HMDB ID | HMDB0000494 |
| Melting Point (Degree C) | 9.73 |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|