| Primary information |
|---|
| ID | 20218 |
| Pubchem ID | 440623 |
| Name | 2-hydroxyestrone |
| Description | catechol estrogen which is a major metabolite of estradiol in man and animals; RN given refers to parent cpd |
| Synonym | Catecholestrone 2-hydroxyestrone 2;3-Dihydroxyestra-1;3;5(10)-trien-17-one 2;3-dihydroxy-estra-1;3;5(10)-trien-17-one Estra-1;3;5(10)-trien-17-one; 2;3-dihydroxy- |
| Molecular Weight | 286.37 |
| Formula | C18H22O3 |
| IUPAC | (8R;9S;13S;14S)-2;3-dihydroxy-13-methyl-7;8;9;11;12;14;15;16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
| SMILE | CC12CCC3C(C1CCC2=O)CCC4=CC(=C(C=C34)O)O |
| PDB ID | NA |
| KEGG | C05298 |
| HMDB ID | HMDB0000343 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|