| Primary information |
|---|
| ID | 20212 |
| Pubchem ID | NA |
| Name | 5a-Dihydrotestosterone sulfate |
| Description | Dihydrotestosterone (DHT) is a steroid similar to testosterone and androstenedione; that belongs to a class called androgens. DHT is a C19 steroid and possesses androgenic activity. Androgen production takes place mainly in the Leydig cells of the testes. Androgens circulate in the blood bound to pr |
| Synonym | NA#5alpha-Dihydrotestosterone sulfate |
| Molecular Weight | 370.5 |
| Formula | C19H30O5S |
| IUPAC | NA |
| SMILE | CC12CCC(=O)CC1CCC1C3CCC(OS(O)(=O)=O)C3(C)CCC21 |
| PDB ID | NA |
| KEGG | NA |
| HMDB ID | HMDB0006278 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|