| Primary information |
|---|
| ID | 20207 |
| Pubchem ID | 107835 |
| Name | 17;20-dihydroxy-4-pregnen-3-one |
| Description | a maturation-inducing hormone; possible role in regulation of testosterone synthesis by rat and rabbit testis; see also record for (20R)-isomer: 1662-06-2; RN given refers to all (alpha)-isomer; structure |
| Synonym | 17alpha;20beta-DP 17a;20a-DHP 17;10beta-P 17;20beta-P 17;20-Dihydroxy-4-pregnen-3-one 17;20beta-Dihydroxy-4-pregnen-3-one 17;21-Dihydroxypregn-4-en-3-one 17alpha;20alpha-Dihydroxyprogesterone |
| Molecular Weight | 332.48 |
| Formula | C21H32O3 |
| IUPAC | (8R;9S;10R;13S;14S;17S)-17-hydroxy-17-(2-hydroxyethyl)-10;13-dimethyl-2;6;7;8;9;11;12;14;15;16-decahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILE | CC12CCC(=O)C=C1CCC3C2CCC4(C3CCC4(CCO)O)C |
| PDB ID | NA |
| KEGG | NA |
| HMDB ID | HMDB0003851 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|