| Primary information |
|---|
| ID | 20196 |
| Pubchem ID | 228491 |
| Name | Epipregnanolone |
| Description | A pregnane found in the urine of pregnant women and sows. It has anesthetic; hypnotic; and sedative properties. |
| Synonym | Epipregnanolone Pregnanolone Pregnanolone I 5.beta.-Pregnanolone Pregnan-3.beta.-ol-20-one 3beta-Hydroxy-5beta-pregnane-20-one 3Beta-hydroxy-5beta-pregnan-20-one (3beta;5beta)-3-hydroxypregnan-2 |
| Molecular Weight | 318.49 |
| Formula | C21H34O2 |
| IUPAC | 1-[(3S;5R;8R;9S;10S;13S;14S;17S)-3-hydroxy-10;13-dimethyl-2;3;4;5;6;7;8;9;11;12;14;15;16;17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone |
| SMILE | CC(=O)C1CCC2C1(CCC3C2CCC4C3(CCC(C4)O)C)C |
| PDB ID | NA |
| KEGG | C11825 |
| HMDB ID | HMDB0001471 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | A3F8U8; Q9GYU4; Q9ARY7; A6H6R7; Q0VEX8; Q14AH9; Q53WT3; Q543Z0; Q544F7; Q544G1; Q5SUU4; Q5SUU5; Q8BHM6; Q8C446; Q8C7N0; Q8CAB3; Q9JLE7; Q9JLE8; Q9JLE9 |
| Reference | HMDB
|