| Primary information |
|---|
| ID | 20195 |
| Pubchem ID | 5710148 |
| Name | 25-Hydroxyvitamin D2 |
| Description | 9;10-Secoergosta-5;7;10(19);22-tetraene-3;25-diol. Biologically active metabolite of vitamin D2 which is more active in curing rickets than its parent. The compound is believed to attach to the same receptor as vitamin D2 and 25-hydroxyvitamin D3. |
| Synonym | 25-Hydroxycalciferol 25-Hydroxyvitamin D 2 25-Hydroxyvitamin D 25-Hydroxyergocalciferol |
| Molecular Weight | 412.65 |
| Formula | C28H44O2 |
| IUPAC | (1S;3Z)-3-[(2E)-2-[(1R;3aS;7aR)-1-[(E;2R;5S)-6-hydroxy-5;6-dimethylhept-3-en-2-yl]-7a-methyl-2;3;3a;5;6;7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexan-1-ol |
| SMILE | CC(C=CC(C)C(C)(C)O)C1CCC2C1(CCCC2=CC=C3CC(CCC3=C)O)C |
| PDB ID | NA |
| KEGG | NA |
| HMDB ID | HMDB0001438 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|