| Primary information |
|---|
| ID | 20183 |
| Pubchem ID | 10594 |
| Name | Taurodeoxycholic Acid |
| Description | A bile salt formed in the liver by conjugation of deoxycholate with taurine; usually as the sodium salt. It is used as a cholagogue and choleretic; also industrially as a fat emulsifier. |
| Synonym | Taurodeoxycholate Deoxycholyltaurine Taurine Deoxycholate TAURODEOXYCHOLIC ACID SODIUM TAURODEOXYCHOLATE Ethanesulfonic acid; 2-(((3alpha;5beta;12alpha)-3;12-dihydroxy-24-oxocholan-24-yl)amino)- |
| Molecular Weight | 499.7 |
| Formula | C26H45NO6S |
| IUPAC | 2-[4-[(3R;5R;8R;9S;10S;12S;13R;14S;17R)-3;12-dihydroxy-10;13-dimethyl-2;3;4;5;6;7;8;9;11;12;14;15;16;17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoylamino]ethanesulfonic acid |
| SMILE | CC(CCC(=O)NCCS(=O)(=O)O)C1CCC2C1(C(CC3C2CCC4C3(CCC(C4)O)C)O)C |
| PDB ID | NA |
| KEGG | C05463 |
| HMDB ID | HMDB0000896 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | Q3SZL0; Q96RI1; Q60641; Q62735 |
| Reference | HMDB
|