| Primary information |
|---|
| ID | 20176 |
| Pubchem ID | NA |
| Name | 5b-Cholestane-3a;7a;12a;23R;25-pentol |
| Description | 5b-Cholestane-3a;7a;12a;23R;25-pentol is a bile alcohol present in the urine of patients with cerebrotendinous xanthomatosis; but not in feces. A possible explanation for the urinary cholestanepentols is that the major serum bile alcohol; 5b-cholestane-3a;7a;12a;25-tetrol; might be hydroxylated at C |
| Synonym | 17-(3;5-dihydroxy-1;5-dimethyl-hexyl)-10;13-dimethyl-hexadecahydro-cyclopenta[a]phenanthrene-3;7;12-triol#5b-Cholestane-3a;7a;12a;23R;25-pentol |
| Molecular Weight | 452.67 |
| Formula | C27H48O5 |
| IUPAC | NA |
| SMILE | CC(CC(O)CC(C)(C)O)C1CCC2C3C(O)CC4CC(O)CCC4(C)C3CC(O)C12C |
| PDB ID | NA |
| KEGG | NA |
| HMDB ID | HMDB0000513 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|