| Primary information |
|---|
| ID | 20173 |
| Pubchem ID | NA |
| Name | 16;17-Epiestriol |
| Description | A hydroxylated metabolite of estradiol or estrone that has a hydroxyl group at C3-beta; 16-; and 17- position. Estriol is a major urinary estrogen. During pregnancy; large amount of estriol is produced by the placenta. Isomers with inversion of the hydroxyl group or groups are called epiestriol (16- |
| Synonym | 16;17-Epiestriol#16;17-epi-Estriol#16b;17a-Estriol#16b-Hydroxy-17a-estradiol#Estra-1;3;5(10)-triene-3;16b;17a-triol#trans-Estriol |
| Molecular Weight | 288.38 |
| Formula | C18H24O3 |
| IUPAC | (16b;17a)-Estra-1;3;5(10)-triene-3;16;17-triol |
| SMILE | CC12CCC3C(CCC4=C3C=CC(O)=C4)C1CC(O)C2O |
| PDB ID | NA |
| KEGG | NA |
| HMDB ID | HMDB0000431 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|