Detailed description page of Hmrbase2
| This page displays user query in tabular form. |
20172 details |
| Primary information | |
|---|---|
| ID | 20172 |
| Pubchem ID | 123655 |
| Name | 18-hydroxycortisol |
| Description | from urine of patients with primary aldosteronism |
| Synonym | 18-hydroxycortisol Pregn-4-en-3-one; 18;20-epoxy-11;17;20;21-tetrahydroxy-; (11beta)- |
| Molecular Weight | 378.46 |
| Formula | C21H30O6 |
| IUPAC | NA |
| SMILE | CC12CCC(=O)C=C1CCC3C2C(CC45C3CCC4(C(OC5)(CO)O)O)O |
| PDB ID | NA |
| KEGG | NA |
| HMDB ID | HMDB0000418 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB |