| Primary information |
|---|
| ID | 20166 |
| Pubchem ID | 256737 |
| Name | 17-Epiestriol |
| Description | A hydroxylated metabolite of ESTRADIOL or ESTRONE that has a hydroxyl group at C3-beta; 16-alpha; and 17-beta position. Estriol is a major urinary estrogen. During PREGNANCY; large amount of estriol is produced by the PLACENTA. Isomers with inversion of the hydroxyl group or groups are called ep |
| Synonym | Epiestriol Estriol 17-Epiestriol |
| Molecular Weight | 288.38 |
| Formula | C18H24O3 |
| IUPAC | (8R;9S;13S;14S;16R;17S)-13-methyl-6;7;8;9;11;12;14;15;16;17-decahydrocyclopenta[a]phenanthrene-3;16;17-triol |
| SMILE | CC12CCC3C(C1CC(C2O)O)CCC4=C3C=CC(=C4)O |
| PDB ID | 2J7Y |
| KEGG | NA |
| HMDB ID | HMDB0000356 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | Q9W669; Q9IAL9; O13012; Q9XSB5; Q95171; Q9PTU5; O93511; Q92731; Q9IAK1; Q9TTE5; P57781; O08537; P57782; Q9YH32; Q9XSW2; Q62986; Q9TU15; Q9W6M2; Q9PVE2 |
| Reference | Pubchem; HMDB
|